C22H16 — CID 90988125
1-(2-cyclohexa-1,4-dien-1-ylethynyl)-2-(2-phenylethynyl)benzene (PubChem CID 90988125) has the molecular formula C22H16 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-cyclohexa-1,4-dien-1-ylethynyl)-2-(2-phenylethynyl)benzene.
| Compound Name | 1-(2-cyclohexa-1,4-dien-1-ylethynyl)-2-(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 90988125 |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(2-cyclohexa-1,4-dien-1-ylethynyl)-2-(2-phenylethynyl)benzene |
| SMILES | C(#Cc1ccccc1C#Cc1ccccc1)C1=CCC=CC1 |
| InChI | InChI=1S/C22H16/c1-3-9-19(10-4-1)15-17-21-13-7-8-14-22(21)18-16-20-11-5-2-6-12-20/h1-5,7-10,12-14H,6,11H2 |
| InChIKey | FHMNMWKBZCGNQR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|