C19H14N2 — CID 139241625
[4-(2-cyclopenta-1,3-dien-1-ylethynyl)phenyl]-phenyldiazene (PubChem CID 139241625) has the molecular formula C19H14N2 and a molecular weight of 270.33 g/mol. Its IUPAC name is [4-(2-cyclopenta-1,3-dien-1-ylethynyl)phenyl]-phenyldiazene.
| Compound Name | [4-(2-cyclopenta-1,3-dien-1-ylethynyl)phenyl]-phenyldiazene |
|---|---|
| PubChem CID | 139241625 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [4-(2-cyclopenta-1,3-dien-1-ylethynyl)phenyl]-phenyldiazene |
| SMILES | C(#Cc1ccc(/N=N/c2ccccc2)cc1)C1=CC=CC1 |
| InChI | InChI=1S/C19H14N2/c1-2-8-18(9-3-1)20-21-19-14-12-17(13-15-19)11-10-16-6-4-5-7-16/h1-6,8-9,12-15H,7H2/b21-20+ |
| InChIKey | HNFPQCIRENBMLK-QZQOTICOSA-N |
| XLogP | 5.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|