C18H14N2O2 — CID 102404378
4-[(3-cyclopenta-1,3-dien-1-ylphenyl)diazenyl]benzoic acid (PubChem CID 102404378) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[(3-cyclopenta-1,3-dien-1-ylphenyl)diazenyl]benzoic acid.
| Compound Name | 4-[(3-cyclopenta-1,3-dien-1-ylphenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 102404378 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[(3-cyclopenta-1,3-dien-1-ylphenyl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=N/c2cccc(C3=CC=CC3)c2)cc1 |
| InChI | InChI=1S/C18H14N2O2/c21-18(22)14-8-10-16(11-9-14)19-20-17-7-3-6-15(12-17)13-4-1-2-5-13/h1-4,6-12H,5H2,(H,21,22)/b20-19+ |
| InChIKey | PPECSAMDRUTYFO-FMQUCBEESA-N |
| XLogP | 5.14 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|