About azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane
azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane (PubChem CID 160807118) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane.
Molecular Properties
| Compound Name | azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane |
| PubChem CID | 160807118 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane |
| SMILES | CC1=CC(C#Cc2ccccc2)=CC1.N.N.S |
| InChI | InChI=1S/C14H12.2H3N.H2S/c1-12-7-8-14(11-12)10-9-13-5-3-2-4-6-13;;;/h2-6,8,11H,7H2,1H3;2*1H3;1H2 |
| InChIKey | PRGNABUOZSZJKX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane?
The IUPAC name of azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane (CID 160807118) is azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane.
What is the SMILES notation for azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane?
The canonical SMILES for azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane is CC1=CC(C#Cc2ccccc2)=CC1.N.N.S.
What is the InChIKey of azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane?
The InChIKey is PRGNABUOZSZJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2H3N.H2S/c1-12-7-8-14(11-12)10-9-13-5-3-2-4-6-13;;;/h2-6,8,11H,7H2,1H3;2*1H3;1H2.
What are the key properties of azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane?
azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane has a molecular weight of 248.39 g/mol, XLogP of 3.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene;sulfane is sourced from PubChem (CID 160807118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).