About 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene
2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene (PubChem CID 123633460) has the molecular formula C14H12
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene.
Molecular Properties
| Compound Name | 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene |
| PubChem CID | 123633460 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene |
| SMILES | CC1=CC(C#Cc2ccccc2)=CC1 |
| InChI | InChI=1S/C14H12/c1-12-7-8-14(11-12)10-9-13-5-3-2-4-6-13/h2-6,8,11H,7H2,1H3 |
| InChIKey | WOLBYBYOIRJXJM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene?
The IUPAC name of 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene (CID 123633460) is 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene.
What is the SMILES notation for 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene?
The canonical SMILES for 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene is CC1=CC(C#Cc2ccccc2)=CC1.
What is the InChIKey of 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene?
The InChIKey is WOLBYBYOIRJXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12/c1-12-7-8-14(11-12)10-9-13-5-3-2-4-6-13/h2-6,8,11H,7H2,1H3.
What are the key properties of 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene?
2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene has a molecular weight of 180.25 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylcyclopenta-1,4-dien-1-yl)ethynylbenzene is sourced from PubChem (CID 123633460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).