C25H29N — CID 142131827
1,4,4-trimethyl-6-[2-(4-methylcyclohepta-1,3,5-trien-1-yl)ethynyl]spiro[3H-quinoline-2,1'-cyclobutane] (PubChem CID 142131827) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is 1,4,4-trimethyl-6-[2-(4-methylcyclohepta-1,3,5-trien-1-yl)ethynyl]spiro[3H-quinoline-2,1'-cyclobutane].
| Compound Name | 1,4,4-trimethyl-6-[2-(4-methylcyclohepta-1,3,5-trien-1-yl)ethynyl]spiro[3H-quinoline-2,1'-cyclobutane] |
|---|---|
| PubChem CID | 142131827 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1,4,4-trimethyl-6-[2-(4-methylcyclohepta-1,3,5-trien-1-yl)ethynyl]spiro[3H-quinoline-2,1'-cyclobutane] |
| SMILES | CC1=CC=C(C#Cc2ccc3c(c2)C(C)(C)CC2(CCC2)N3C)CC=C1 |
| InChI | InChI=1S/C25H29N/c1-19-7-5-8-20(10-9-19)11-12-21-13-14-23-22(17-21)24(2,3)18-25(26(23)4)15-6-16-25/h5,7,9-10,13-14,17H,6,8,15-16,18H2,1-4H3 |
| InChIKey | AMXABXQVHIPXOZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|