C21H21Br — CID 102028478
5-[2-(4-bromophenyl)ethynyl]-1,1,3,3-tetramethyl-2H-indene (PubChem CID 102028478) has the molecular formula C21H21Br and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-[2-(4-bromophenyl)ethynyl]-1,1,3,3-tetramethyl-2H-indene.
| Compound Name | 5-[2-(4-bromophenyl)ethynyl]-1,1,3,3-tetramethyl-2H-indene |
|---|---|
| PubChem CID | 102028478 |
| Molecular Formula | C21H21Br |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-[2-(4-bromophenyl)ethynyl]-1,1,3,3-tetramethyl-2H-indene |
| SMILES | CC1(C)CC(C)(C)c2cc(C#Cc3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C21H21Br/c1-20(2)14-21(3,4)19-13-16(9-12-18(19)20)6-5-15-7-10-17(22)11-8-15/h7-13H,14H2,1-4H3 |
| InChIKey | HATRTPSWAKWYQH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|