C18H26SSi — CID 15661127
trimethyl-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]silane (PubChem CID 15661127) has the molecular formula C18H26SSi and a molecular weight of 302.56 g/mol. Its IUPAC name is trimethyl-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]silane |
|---|---|
| PubChem CID | 15661127 |
| Molecular Formula | C18H26SSi |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | trimethyl-[2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)ethynyl]silane |
| SMILES | CC1(C)CC(C)(C)c2cc(C#C[Si](C)(C)C)ccc2S1 |
| InChI | InChI=1S/C18H26SSi/c1-17(2)13-18(3,4)19-16-9-8-14(12-15(16)17)10-11-20(5,6)7/h8-9,12H,13H2,1-7H3 |
| InChIKey | FOMJNJXEFLIPHL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|