C20H23N — CID 134256191
4,4-dimethyl-6-[(E)-3-methylpent-3-en-1-ynyl]-1-prop-2-ynyl-2,3-dihydroquinoline (PubChem CID 134256191) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 4,4-dimethyl-6-[(E)-3-methylpent-3-en-1-ynyl]-1-prop-2-ynyl-2,3-dihydroquinoline.
| Compound Name | 4,4-dimethyl-6-[(E)-3-methylpent-3-en-1-ynyl]-1-prop-2-ynyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 134256191 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4,4-dimethyl-6-[(E)-3-methylpent-3-en-1-ynyl]-1-prop-2-ynyl-2,3-dihydroquinoline |
| SMILES | C#CCN1CCC(C)(C)c2cc(C#C/C(C)=C/C)ccc21 |
| InChI | InChI=1S/C20H23N/c1-6-13-21-14-12-20(4,5)18-15-17(10-11-19(18)21)9-8-16(3)7-2/h1,7,10-11,15H,12-14H2,2-5H3/b16-7+ |
| InChIKey | NFFQOIGWAMZJFL-FRKPEAEDSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|