C11H16N2O2 — CID 143493354
(5-aminocyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone (PubChem CID 143493354) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (5-aminocyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-aminocyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 143493354 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (5-aminocyclohexa-1,3-dien-1-yl)-morpholin-4-ylmethanone |
| SMILES | NC1C=CC=C(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C11H16N2O2/c12-10-3-1-2-9(8-10)11(14)13-4-6-15-7-5-13/h1-3,10H,4-8,12H2 |
| InChIKey | XNLLLNZZFNWXDL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |