C9H11N3O3S — CID 174869573
2-(morpholine-4-carbonyl)-1,3-thiazole-4-carboxamide (PubChem CID 174869573) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-(morpholine-4-carbonyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(morpholine-4-carbonyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 174869573 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(morpholine-4-carbonyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(C(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C9H11N3O3S/c10-7(13)6-5-16-8(11-6)9(14)12-1-3-15-4-2-12/h5H,1-4H2,(H2,10,13) |
| InChIKey | WNXRSOLJOPKMFR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |