C14H13Cl2N3O2S — CID 4222905
[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 4222905) has the molecular formula C14H13Cl2N3O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 4222905 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | [2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1csc(Nc2ccc(Cl)c(Cl)c2)n1)N1CCOCC1 |
| InChI | InChI=1S/C14H13Cl2N3O2S/c15-10-2-1-9(7-11(10)16)17-14-18-12(8-22-14)13(20)19-3-5-21-6-4-19/h1-2,7-8H,3-6H2,(H,17,18) |
| InChIKey | AXWKSJIKSVMTLM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |