About 5-ethylcyclohexa-1,3-dien-1-ol
5-ethylcyclohexa-1,3-dien-1-ol (PubChem CID 154505680) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 5-ethylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 5-ethylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 154505680 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 5-ethylcyclohexa-1,3-dien-1-ol |
| SMILES | CCC1C=CC=C(O)C1 |
| InChI | InChI=1S/C8H12O/c1-2-7-4-3-5-8(9)6-7/h3-5,7,9H,2,6H2,1H3 |
| InChIKey | VJNKQCNVLFAYQO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 5-ethylcyclohexa-1,3-dien-1-ol (CID 154505680) is 5-ethylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 5-ethylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 5-ethylcyclohexa-1,3-dien-1-ol is CCC1C=CC=C(O)C1.
What is the InChIKey of 5-ethylcyclohexa-1,3-dien-1-ol?
The InChIKey is VJNKQCNVLFAYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-2-7-4-3-5-8(9)6-7/h3-5,7,9H,2,6H2,1H3.
What are the key properties of 5-ethylcyclohexa-1,3-dien-1-ol?
5-ethylcyclohexa-1,3-dien-1-ol has a molecular weight of 124.18 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 154505680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).