C12H18 — CID 14764390
5-butyl-1-ethenylcyclohexa-1,3-diene (PubChem CID 14764390) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 5-butyl-1-ethenylcyclohexa-1,3-diene.
| Compound Name | 5-butyl-1-ethenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 14764390 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 5-butyl-1-ethenylcyclohexa-1,3-diene |
| SMILES | C=CC1=CC=CC(CCCC)C1 |
| InChI | InChI=1S/C12H18/c1-3-5-7-12-9-6-8-11(4-2)10-12/h4,6,8-9,12H,2-3,5,7,10H2,1H3 |
| InChIKey | NVUARUYKDBEOCD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |