C17H29NO — CID 130373360
3-[5-(2-propylpent-4-enoxy)cyclohexa-2,4-dien-1-yl]propan-1-amine (PubChem CID 130373360) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 3-[5-(2-propylpent-4-enoxy)cyclohexa-2,4-dien-1-yl]propan-1-amine.
| Compound Name | 3-[5-(2-propylpent-4-enoxy)cyclohexa-2,4-dien-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 130373360 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 3-[5-(2-propylpent-4-enoxy)cyclohexa-2,4-dien-1-yl]propan-1-amine |
| SMILES | C=CCC(CCC)COC1=CC=CC(CCCN)C1 |
| InChI | InChI=1S/C17H29NO/c1-3-7-16(8-4-2)14-19-17-11-5-9-15(13-17)10-6-12-18/h3,5,9,11,15-16H,1,4,6-8,10,12-14,18H2,2H3 |
| InChIKey | CONDEVOPWGHGKX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|