C18H27NO — CID 14938253
2-[(5S,6R)-6-butyl-5-prop-2-enylcyclohexa-1,3-dien-1-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 14938253) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-[(5S,6R)-6-butyl-5-prop-2-enylcyclohexa-1,3-dien-1-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(5S,6R)-6-butyl-5-prop-2-enylcyclohexa-1,3-dien-1-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 14938253 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-[(5S,6R)-6-butyl-5-prop-2-enylcyclohexa-1,3-dien-1-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | C=CC[C@H]1C=CC=C(C2=NC(C)(C)CO2)[C@@H]1CCCC |
| InChI | InChI=1S/C18H27NO/c1-5-7-11-15-14(9-6-2)10-8-12-16(15)17-19-18(3,4)13-20-17/h6,8,10,12,14-15H,2,5,7,9,11,13H2,1,3-4H3/t14-,15+/m0/s1 |
| InChIKey | MWYNMHXVMGPEFK-LSDHHAIUSA-N |
| XLogP | 4.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|