About 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde
4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde (PubChem CID 175377299) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde |
| PubChem CID | 175377299 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde |
| SMILES | CCCCc1ccc(C=O)c(C2=NC(C)(C)CO2)c1 |
| InChI | InChI=1S/C16H21NO2/c1-4-5-6-12-7-8-13(10-18)14(9-12)15-17-16(2,3)11-19-15/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | JTBQEEZGRUWFSO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde?
The IUPAC name of 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde (CID 175377299) is 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde.
What is the SMILES notation for 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde?
The canonical SMILES for 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde is CCCCc1ccc(C=O)c(C2=NC(C)(C)CO2)c1.
What is the InChIKey of 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde?
The InChIKey is JTBQEEZGRUWFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-4-5-6-12-7-8-13(10-18)14(9-12)15-17-16(2,3)11-19-15/h7-10H,4-6,11H2,1-3H3.
What are the key properties of 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde?
4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde has a molecular weight of 259.35 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde is sourced from PubChem (CID 175377299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).