C16H21NO2 — CID 175377299
4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde (PubChem CID 175377299) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde.
| Compound Name | 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 175377299 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-butyl-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)benzaldehyde |
| SMILES | CCCCc1ccc(C=O)c(C2=NC(C)(C)CO2)c1 |
| InChI | InChI=1S/C16H21NO2/c1-4-5-6-12-7-8-13(10-18)14(9-12)15-17-16(2,3)11-19-15/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | JTBQEEZGRUWFSO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|