C16H18FNO — CID 20625406
2-(2-fluoro-4-pent-3-ynylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 20625406) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 2-(2-fluoro-4-pent-3-ynylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(2-fluoro-4-pent-3-ynylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 20625406 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-(2-fluoro-4-pent-3-ynylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC#CCCc1ccc(C2=NC(C)(C)CO2)c(F)c1 |
| InChI | InChI=1S/C16H18FNO/c1-4-5-6-7-12-8-9-13(14(17)10-12)15-18-16(2,3)11-19-15/h8-10H,6-7,11H2,1-3H3 |
| InChIKey | NDBRKABHVXLXKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|