C24H30N2O — CID 10784892
(1R,2S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-N,N,2-tris(prop-2-enyl)-1,2-dihydronaphthalen-1-amine (PubChem CID 10784892) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is (1R,2S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-N,N,2-tris(prop-2-enyl)-1,2-dihydronaphthalen-1-amine.
| Compound Name | (1R,2S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-N,N,2-tris(prop-2-enyl)-1,2-dihydronaphthalen-1-amine |
|---|---|
| PubChem CID | 10784892 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (1R,2S)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-N,N,2-tris(prop-2-enyl)-1,2-dihydronaphthalen-1-amine |
| SMILES | C=CC[C@H]1C=C(C2=NC(C)(C)CO2)c2ccccc2[C@@H]1N(CC=C)CC=C |
| InChI | InChI=1S/C24H30N2O/c1-6-11-18-16-21(23-25-24(4,5)17-27-23)19-12-9-10-13-20(19)22(18)26(14-7-2)15-8-3/h6-10,12-13,16,18,22H,1-3,11,14-15,17H2,4-5H3/t18-,22+/m0/s1 |
| InChIKey | KNJOZECFNMPYFD-PGRDOPGGSA-N |
| XLogP | 5.20 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|