C17H23NO — CID 15880000
2-(2-cyclohexylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 15880000) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(2-cyclohexylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(2-cyclohexylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 15880000 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-(2-cyclohexylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccccc2C2CCCCC2)=N1 |
| InChI | InChI=1S/C17H23NO/c1-17(2)12-19-16(18-17)15-11-7-6-10-14(15)13-8-4-3-5-9-13/h6-7,10-11,13H,3-5,8-9,12H2,1-2H3 |
| InChIKey | ONUBMPTUJUGTPZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |