C8H14O — CID 118421437
(3R,4R)-4-ethyl-3-methylcyclopenten-1-ol (PubChem CID 118421437) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (3R,4R)-4-ethyl-3-methylcyclopenten-1-ol.
| Compound Name | (3R,4R)-4-ethyl-3-methylcyclopenten-1-ol |
|---|---|
| PubChem CID | 118421437 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (3R,4R)-4-ethyl-3-methylcyclopenten-1-ol |
| SMILES | CC[C@@H]1CC(O)=C[C@@H]1C |
| InChI | InChI=1S/C8H14O/c1-3-7-5-8(9)4-6(7)2/h4,6-7,9H,3,5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | XDNAYIBVGMTAJA-NKWVEPMBSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |