C6H10INO — CID 139453501
1-iodo-2,3-dimethyl-2,3-dihydropyrrol-5-ol (PubChem CID 139453501) has the molecular formula C6H10INO and a molecular weight of 239.06 g/mol. Its IUPAC name is 1-iodo-2,3-dimethyl-2,3-dihydropyrrol-5-ol.
| Compound Name | 1-iodo-2,3-dimethyl-2,3-dihydropyrrol-5-ol |
|---|---|
| PubChem CID | 139453501 |
| Molecular Formula | C6H10INO |
| Molecular Weight | 239.06 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 1-iodo-2,3-dimethyl-2,3-dihydropyrrol-5-ol |
| SMILES | CC1C=C(O)N(I)C1C |
| InChI | InChI=1S/C6H10INO/c1-4-3-6(9)8(7)5(4)2/h3-5,9H,1-2H3 |
| InChIKey | PAFGRDYOHKJZSH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|