About 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one
5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one (PubChem CID 129106299) has the molecular formula C6H10INO2
and a molecular weight of 255.06 g/mol. Its IUPAC name is 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one |
| PubChem CID | 129106299 |
| Molecular Formula | C6H10INO2 |
| Molecular Weight | 255.06 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one |
| SMILES | CC1C(=O)N(I)C(O)C1C |
| InChI | InChI=1S/C6H10INO2/c1-3-4(2)6(10)8(7)5(3)9/h3-5,9H,1-2H3 |
| InChIKey | QHBPUGSEKBDYJS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.06 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one?
The IUPAC name of 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one (CID 129106299) is 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one.
What is the SMILES notation for 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one?
The canonical SMILES for 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one is CC1C(=O)N(I)C(O)C1C.
What is the InChIKey of 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one?
The InChIKey is QHBPUGSEKBDYJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10INO2/c1-3-4(2)6(10)8(7)5(3)9/h3-5,9H,1-2H3.
What are the key properties of 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one?
5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one has a molecular weight of 255.06 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1-iodo-3,4-dimethylpyrrolidin-2-one is sourced from PubChem (CID 129106299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).