About 1-iodo-3,4,5-trimethylimidazolidin-2-one
1-iodo-3,4,5-trimethylimidazolidin-2-one (PubChem CID 154991596) has the molecular formula C6H11IN2O
and a molecular weight of 254.07 g/mol. Its IUPAC name is 1-iodo-3,4,5-trimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 1-iodo-3,4,5-trimethylimidazolidin-2-one |
| PubChem CID | 154991596 |
| Molecular Formula | C6H11IN2O |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-iodo-3,4,5-trimethylimidazolidin-2-one |
| SMILES | CC1C(C)N(I)C(=O)N1C |
| InChI | InChI=1S/C6H11IN2O/c1-4-5(2)9(7)6(10)8(4)3/h4-5H,1-3H3 |
| InChIKey | RWXJYRHKUPOUSR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-3,4,5-trimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-3,4,5-trimethylimidazolidin-2-one?
The IUPAC name of 1-iodo-3,4,5-trimethylimidazolidin-2-one (CID 154991596) is 1-iodo-3,4,5-trimethylimidazolidin-2-one.
What is the SMILES notation for 1-iodo-3,4,5-trimethylimidazolidin-2-one?
The canonical SMILES for 1-iodo-3,4,5-trimethylimidazolidin-2-one is CC1C(C)N(I)C(=O)N1C.
What is the InChIKey of 1-iodo-3,4,5-trimethylimidazolidin-2-one?
The InChIKey is RWXJYRHKUPOUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IN2O/c1-4-5(2)9(7)6(10)8(4)3/h4-5H,1-3H3.
What are the key properties of 1-iodo-3,4,5-trimethylimidazolidin-2-one?
1-iodo-3,4,5-trimethylimidazolidin-2-one has a molecular weight of 254.07 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-3,4,5-trimethylimidazolidin-2-one is sourced from PubChem (CID 154991596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).