C6H11IN2O — CID 154991596
1-iodo-3,4,5-trimethylimidazolidin-2-one (PubChem CID 154991596) has the molecular formula C6H11IN2O and a molecular weight of 254.07 g/mol. Its IUPAC name is 1-iodo-3,4,5-trimethylimidazolidin-2-one.
| Compound Name | 1-iodo-3,4,5-trimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 154991596 |
| Molecular Formula | C6H11IN2O |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-iodo-3,4,5-trimethylimidazolidin-2-one |
| SMILES | CC1C(C)N(I)C(=O)N1C |
| InChI | InChI=1S/C6H11IN2O/c1-4-5(2)9(7)6(10)8(4)3/h4-5H,1-3H3 |
| InChIKey | RWXJYRHKUPOUSR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|