C7H13FN2O — CID 67255469
4-(2-fluoroethyl)-1,3-dimethylimidazolidin-2-one (PubChem CID 67255469) has the molecular formula C7H13FN2O and a molecular weight of 160.19 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4-(2-fluoroethyl)-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 67255469 |
| Molecular Formula | C7H13FN2O |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-(2-fluoroethyl)-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1CC(CCF)N(C)C1=O |
| InChI | InChI=1S/C7H13FN2O/c1-9-5-6(3-4-8)10(2)7(9)11/h6H,3-5H2,1-2H3 |
| InChIKey | WILQYMQMUFITRL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |