C6H11FN2O — CID 67255737
4-(fluoromethyl)-1,3-dimethylimidazolidin-2-one (PubChem CID 67255737) has the molecular formula C6H11FN2O and a molecular weight of 146.16 g/mol. Its IUPAC name is 4-(fluoromethyl)-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4-(fluoromethyl)-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 67255737 |
| Molecular Formula | C6H11FN2O |
| Molecular Weight | 146.16 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 4-(fluoromethyl)-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1CC(CF)N(C)C1=O |
| InChI | InChI=1S/C6H11FN2O/c1-8-4-5(3-7)9(2)6(8)10/h5H,3-4H2,1-2H3 |
| InChIKey | PXOOFEXZZJWERN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |