C7H9FN2O — CID 89446167
4-(2-fluoroethynyl)-1,3-dimethylimidazolidin-2-one (PubChem CID 89446167) has the molecular formula C7H9FN2O and a molecular weight of 156.16 g/mol. Its IUPAC name is 4-(2-fluoroethynyl)-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4-(2-fluoroethynyl)-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 89446167 |
| Molecular Formula | C7H9FN2O |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-(2-fluoroethynyl)-1,3-dimethylimidazolidin-2-one |
| SMILES | CN1CC(C#CF)N(C)C1=O |
| InChI | InChI=1S/C7H9FN2O/c1-9-5-6(3-4-8)10(2)7(9)11/h6H,5H2,1-2H3 |
| InChIKey | KEUZBUXPDVEFJF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|