C8H13NO3 — CID 59113726
(3S)-5-acetyl-3-hydroxy-1,4-dimethylpyrrolidin-2-one (PubChem CID 59113726) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (3S)-5-acetyl-3-hydroxy-1,4-dimethylpyrrolidin-2-one.
| Compound Name | (3S)-5-acetyl-3-hydroxy-1,4-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 59113726 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (3S)-5-acetyl-3-hydroxy-1,4-dimethylpyrrolidin-2-one |
| SMILES | CC(=O)C1C(C)[C@H](O)C(=O)N1C |
| InChI | InChI=1S/C8H13NO3/c1-4-6(5(2)10)9(3)8(12)7(4)11/h4,6-7,11H,1-3H3/t4?,6?,7-/m0/s1 |
| InChIKey | KIOAXYYOTSXBKJ-QURAEUELSA-N |
| XLogP | -0.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |