C9H12N2O3 — CID 85271947
1-acetyl-3,4-dimethyl-6-methylidenepiperazine-2,5-dione (PubChem CID 85271947) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-acetyl-3,4-dimethyl-6-methylidenepiperazine-2,5-dione.
| Compound Name | 1-acetyl-3,4-dimethyl-6-methylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 85271947 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-acetyl-3,4-dimethyl-6-methylidenepiperazine-2,5-dione |
| SMILES | C=C1C(=O)N(C)C(C)C(=O)N1C(C)=O |
| InChI | InChI=1S/C9H12N2O3/c1-5-9(14)11(7(3)12)6(2)8(13)10(5)4/h5H,2H2,1,3-4H3 |
| InChIKey | PSZUUIZBLXNXMW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|