C10H12N2O4 — CID 10680630
(3S)-1,4-diacetyl-3-methyl-6-methylidenepiperazine-2,5-dione (PubChem CID 10680630) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (3S)-1,4-diacetyl-3-methyl-6-methylidenepiperazine-2,5-dione.
| Compound Name | (3S)-1,4-diacetyl-3-methyl-6-methylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 10680630 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (3S)-1,4-diacetyl-3-methyl-6-methylidenepiperazine-2,5-dione |
| SMILES | C=C1C(=O)N(C(C)=O)[C@@H](C)C(=O)N1C(C)=O |
| InChI | InChI=1S/C10H12N2O4/c1-5-9(15)12(8(4)14)6(2)10(16)11(5)7(3)13/h6H,1H2,2-4H3/t6-/m0/s1 |
| InChIKey | HFJRVZQATWGDMD-LURJTMIESA-N |
| XLogP | -0.35 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|