C7H12N2O — CID 58748682
1,4-dimethyl-3-methylidenepiperazin-2-one (PubChem CID 58748682) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,4-dimethyl-3-methylidenepiperazin-2-one.
| Compound Name | 1,4-dimethyl-3-methylidenepiperazin-2-one |
|---|---|
| PubChem CID | 58748682 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1,4-dimethyl-3-methylidenepiperazin-2-one |
| SMILES | C=C1C(=O)N(C)CCN1C |
| InChI | InChI=1S/C7H12N2O/c1-6-7(10)9(3)5-4-8(6)2/h1,4-5H2,2-3H3 |
| InChIKey | KCUKILXZQHSJBL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|