C12H14N2O4 — CID 139972962
1,4-bis(2-methylprop-2-enoyl)piperazine-2,3-dione (PubChem CID 139972962) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1,4-bis(2-methylprop-2-enoyl)piperazine-2,3-dione.
| Compound Name | 1,4-bis(2-methylprop-2-enoyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 139972962 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1,4-bis(2-methylprop-2-enoyl)piperazine-2,3-dione |
| SMILES | C=C(C)C(=O)N1CCN(C(=O)C(=C)C)C(=O)C1=O |
| InChI | InChI=1S/C12H14N2O4/c1-7(2)9(15)13-5-6-14(10(16)8(3)4)12(18)11(13)17/h1,3,5-6H2,2,4H3 |
| InChIKey | OQLUTGFRHQGSFF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|