C8H15NO — CID 123697315
1,4-diethyl-3-methylazetidin-2-one (PubChem CID 123697315) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1,4-diethyl-3-methylazetidin-2-one.
| Compound Name | 1,4-diethyl-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 123697315 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1,4-diethyl-3-methylazetidin-2-one |
| SMILES | CCC1C(C)C(=O)N1CC |
| InChI | InChI=1S/C8H15NO/c1-4-7-6(3)8(10)9(7)5-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | BBCDAFFXLUQLRF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |