C7H14N4O3S — CID 1492482
(3aR,6aR)-4,6-diethyl-2,2-dioxo-1,3,3a,6a-tetrahydroimidazo[4,5-c][1,2,5]thiadiazol-5-one (PubChem CID 1492482) has the molecular formula C7H14N4O3S and a molecular weight of 234.28 g/mol. Its IUPAC name is (3aR,6aR)-4,6-diethyl-2,2-dioxo-1,3,3a,6a-tetrahydroimidazo[4,5-c][1,2,5]thiadiazol-5-one.
| Compound Name | (3aR,6aR)-4,6-diethyl-2,2-dioxo-1,3,3a,6a-tetrahydroimidazo[4,5-c][1,2,5]thiadiazol-5-one |
|---|---|
| PubChem CID | 1492482 |
| Molecular Formula | C7H14N4O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (3aR,6aR)-4,6-diethyl-2,2-dioxo-1,3,3a,6a-tetrahydroimidazo[4,5-c][1,2,5]thiadiazol-5-one |
| SMILES | CCN1C(=O)N(CC)[C@@H]2NS(=O)(=O)N[C@H]21 |
| InChI | InChI=1S/C7H14N4O3S/c1-3-10-5-6(9-15(13,14)8-5)11(4-2)7(10)12/h5-6,8-9H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | UPJYOTWLCIPDPJ-WDSKDSINSA-N |
| XLogP | -1.15 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |