C16H20N4O3 — CID 74925915
1,3-diethyl-5-phenyl-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925915) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1,3-diethyl-5-phenyl-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3-diethyl-5-phenyl-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925915 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1,3-diethyl-5-phenyl-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | CCN1C(=O)C2C(c3ccccc3)NC(=O)NC2N(CC)C1=O |
| InChI | InChI=1S/C16H20N4O3/c1-3-19-13-11(14(21)20(4-2)16(19)23)12(17-15(22)18-13)10-8-6-5-7-9-10/h5-9,11-13H,3-4H2,1-2H3,(H2,17,18,22) |
| InChIKey | CSOLLLZJRMFCAB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |