C23H26N4O4 — CID 74925892
1,3-diethyl-5-(4-phenylmethoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925892) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1,3-diethyl-5-(4-phenylmethoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3-diethyl-5-(4-phenylmethoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925892 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1,3-diethyl-5-(4-phenylmethoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | CCN1C(=O)C2C(c3ccc(OCc4ccccc4)cc3)NC(=O)NC2N(CC)C1=O |
| InChI | InChI=1S/C23H26N4O4/c1-3-26-20-18(21(28)27(4-2)23(26)30)19(24-22(29)25-20)16-10-12-17(13-11-16)31-14-15-8-6-5-7-9-15/h5-13,18-20H,3-4,14H2,1-2H3,(H2,24,25,29) |
| InChIKey | NZJJINZRAIWITP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |