C23H19NO3 — CID 57032337
1-phenyl-3-(4-phenylmethoxyphenyl)pyrrolidine-2,4-dione (PubChem CID 57032337) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-phenyl-3-(4-phenylmethoxyphenyl)pyrrolidine-2,4-dione.
| Compound Name | 1-phenyl-3-(4-phenylmethoxyphenyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 57032337 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-phenyl-3-(4-phenylmethoxyphenyl)pyrrolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO3/c25-21-15-24(19-9-5-2-6-10-19)23(26)22(21)18-11-13-20(14-12-18)27-16-17-7-3-1-4-8-17/h1-14,22H,15-16H2 |
| InChIKey | FJWPKNORKUTNJV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|