C22H24N4O5 — CID 74925779
1-benzyl-5-(3-ethoxy-4-methoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 74925779) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-benzyl-5-(3-ethoxy-4-methoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-benzyl-5-(3-ethoxy-4-methoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 74925779 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-benzyl-5-(3-ethoxy-4-methoxyphenyl)-5,6,8,8a-tetrahydro-4aH-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | CCOc1cc(C2NC(=O)NC3C2C(=O)NC(=O)N3Cc2ccccc2)ccc1OC |
| InChI | InChI=1S/C22H24N4O5/c1-3-31-16-11-14(9-10-15(16)30-2)18-17-19(24-21(28)23-18)26(22(29)25-20(17)27)12-13-7-5-4-6-8-13/h4-11,17-19H,3,12H2,1-2H3,(H2,23,24,28)(H,25,27,29) |
| InChIKey | JQJJHQJCTRDJST-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |