C22H23N3O3S2 — CID 78406802
3-benzyl-5-(3-methoxy-4-prop-2-enoxyphenyl)-2-sulfanylidene-4,5,6,7a-tetrahydro-3aH-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 78406802) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 3-benzyl-5-(3-methoxy-4-prop-2-enoxyphenyl)-2-sulfanylidene-4,5,6,7a-tetrahydro-3aH-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-5-(3-methoxy-4-prop-2-enoxyphenyl)-2-sulfanylidene-4,5,6,7a-tetrahydro-3aH-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 78406802 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 3-benzyl-5-(3-methoxy-4-prop-2-enoxyphenyl)-2-sulfanylidene-4,5,6,7a-tetrahydro-3aH-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | C=CCOc1ccc(C2NC(=O)C3SC(=S)N(Cc4ccccc4)C3N2)cc1OC |
| InChI | InChI=1S/C22H23N3O3S2/c1-3-11-28-16-10-9-15(12-17(16)27-2)19-23-20-18(21(26)24-19)30-22(29)25(20)13-14-7-5-4-6-8-14/h3-10,12,18-20,23H,1,11,13H2,2H3,(H,24,26) |
| InChIKey | NBSXHCFVGLHRFZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|