C11H19N5O3S — CID 139200287
(2R,6S)-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione;methanol (PubChem CID 139200287) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (2R,6S)-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione;methanol.
| Compound Name | (2R,6S)-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione;methanol |
|---|---|
| PubChem CID | 139200287 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2R,6S)-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione;methanol |
| SMILES | CCN1C(=O)N(CC)[C@H]2NN=C3SCC(=O)N3[C@H]21.CO |
| InChI | InChI=1S/C10H15N5O2S.CH4O/c1-3-13-7-8(14(4-2)10(13)17)15-6(16)5-18-9(15)12-11-7;1-2/h7-8,11H,3-5H2,1-2H3;2H,1H3/t7-,8-;/m1./s1 |
| InChIKey | SSIOYVACTCYYIX-SCLLHFNJSA-N |
| XLogP | -0.53 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |