C17H19N5O2S — CID 162395426
(11Z)-11-benzylidene-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione (PubChem CID 162395426) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is (11Z)-11-benzylidene-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione.
| Compound Name | (11Z)-11-benzylidene-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione |
|---|---|
| PubChem CID | 162395426 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (11Z)-11-benzylidene-3,5-diethyl-10-thia-1,3,5,7,8-pentazatricyclo[7.3.0.02,6]dodec-8-ene-4,12-dione |
| SMILES | CCN1C(=O)N(CC)C2C1NN=c1s/c(=C\c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C17H19N5O2S/c1-3-20-13-14(21(4-2)17(20)24)22-15(23)12(25-16(22)19-18-13)10-11-8-6-5-7-9-11/h5-10,13-14,18H,3-4H2,1-2H3/b12-10- |
| InChIKey | KGTFGXJFWAHYLR-BENRWUELSA-N |
| XLogP | 0.48 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |