C16H21N7O2S — CID 164889597
(11Z)-11-[(2,3-dimethylimidazol-4-yl)methylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione (PubChem CID 164889597) has the molecular formula C16H21N7O2S and a molecular weight of 375.46 g/mol. Its IUPAC name is (11Z)-11-[(2,3-dimethylimidazol-4-yl)methylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione.
| Compound Name | (11Z)-11-[(2,3-dimethylimidazol-4-yl)methylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 164889597 |
| Molecular Formula | C16H21N7O2S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (11Z)-11-[(2,3-dimethylimidazol-4-yl)methylidene]-4,6-diethyl-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-ene-5,12-dione |
| SMILES | CCN1C(=O)N(CC)C2Nn3c(s/c(=C\c4cnc(C)n4C)c3=O)=NC21 |
| InChI | InChI=1S/C16H21N7O2S/c1-5-21-12-13(22(6-2)16(21)25)19-23-14(24)11(26-15(23)18-12)7-10-8-17-9(3)20(10)4/h7-8,12-13,19H,5-6H2,1-4H3/b11-7- |
| InChIKey | PNZXCIWWYJAGEW-XFFZJAGNSA-N |
| XLogP | -0.61 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |