C14H19N5O4S — CID 171365005
ethyl (2Z)-2-(4,6-diethyl-5,12-dioxo-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-en-11-ylidene)acetate (PubChem CID 171365005) has the molecular formula C14H19N5O4S and a molecular weight of 353.40 g/mol. Its IUPAC name is ethyl (2Z)-2-(4,6-diethyl-5,12-dioxo-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-en-11-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(4,6-diethyl-5,12-dioxo-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-en-11-ylidene)acetate |
|---|---|
| PubChem CID | 171365005 |
| Molecular Formula | C14H19N5O4S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl (2Z)-2-(4,6-diethyl-5,12-dioxo-10-thia-1,2,4,6,8-pentazatricyclo[7.3.0.03,7]dodec-8-en-11-ylidene)acetate |
| SMILES | CCOC(=O)/C=c1\sc2n(c1=O)NC1C(N=2)N(CC)C(=O)N1CC |
| InChI | InChI=1S/C14H19N5O4S/c1-4-17-10-11(18(5-2)14(17)22)16-19-12(21)8(24-13(19)15-10)7-9(20)23-6-3/h7,10-11,16H,4-6H2,1-3H3/b8-7- |
| InChIKey | KVPKKNNDOAPLRO-FPLPWBNLSA-N |
| XLogP | -1.14 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |