C24H16FN3OS — CID 7357706
(4R,7E)-7-[(4-fluorophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one (PubChem CID 7357706) has the molecular formula C24H16FN3OS and a molecular weight of 413.48 g/mol. Its IUPAC name is (4R,7E)-7-[(4-fluorophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one.
| Compound Name | (4R,7E)-7-[(4-fluorophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 7357706 |
| Molecular Formula | C24H16FN3OS |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (4R,7E)-7-[(4-fluorophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
| SMILES | O=c1/c(=C\c2ccc(F)cc2)sc2n1[C@H](c1ccccc1)C(c1ccccc1)=NN=2 |
| InChI | InChI=1S/C24H16FN3OS/c25-19-13-11-16(12-14-19)15-20-23(29)28-22(18-9-5-2-6-10-18)21(26-27-24(28)30-20)17-7-3-1-4-8-17/h1-15,22H/b20-15+/t22-/m1/s1 |
| InChIKey | CTIJMAOYFUREBS-GFCAVMEOSA-N |
| XLogP | 3.50 |
| TPSA | 46.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |