C25H17N3O2S — CID 40891116
4-[(E)-[(4S)-6-oxo-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-7-ylidene]methyl]benzaldehyde (PubChem CID 40891116) has the molecular formula C25H17N3O2S and a molecular weight of 423.50 g/mol. Its IUPAC name is 4-[(E)-[(4S)-6-oxo-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-7-ylidene]methyl]benzaldehyde.
| Compound Name | 4-[(E)-[(4S)-6-oxo-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-7-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 40891116 |
| Molecular Formula | C25H17N3O2S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 4-[(E)-[(4S)-6-oxo-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-7-ylidene]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(/C=c2/sc3n(c2=O)[C@@H](c2ccccc2)C(c2ccccc2)=NN=3)cc1 |
| InChI | InChI=1S/C25H17N3O2S/c29-16-18-13-11-17(12-14-18)15-21-24(30)28-23(20-9-5-2-6-10-20)22(26-27-25(28)31-21)19-7-3-1-4-8-19/h1-16,23H/b21-15+/t23-/m0/s1 |
| InChIKey | OALPZFJPSSTQMB-QFVBLGFASA-N |
| XLogP | 3.18 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|