C24H16N4O3S — CID 5291739
(7Z)-7-[(4-nitrophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one (PubChem CID 5291739) has the molecular formula C24H16N4O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is (7Z)-7-[(4-nitrophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one.
| Compound Name | (7Z)-7-[(4-nitrophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 5291739 |
| Molecular Formula | C24H16N4O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (7Z)-7-[(4-nitrophenyl)methylidene]-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
| SMILES | O=c1/c(=C/c2ccc([N+](=O)[O-])cc2)sc2n1C(c1ccccc1)C(c1ccccc1)=NN=2 |
| InChI | InChI=1S/C24H16N4O3S/c29-23-20(15-16-11-13-19(14-12-16)28(30)31)32-24-26-25-21(17-7-3-1-4-8-17)22(27(23)24)18-9-5-2-6-10-18/h1-15,22H/b20-15- |
| InChIKey | OYXBIPVIGMLNOH-HKWRFOASSA-N |
| XLogP | 3.27 |
| TPSA | 89.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|