C27H18FN3O3S — CID 23944695
14-[(4-fluorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23944695) has the molecular formula C27H18FN3O3S and a molecular weight of 483.52 g/mol. Its IUPAC name is 14-[(4-fluorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(4-fluorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23944695 |
| Molecular Formula | C27H18FN3O3S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 14-[(4-fluorophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1c(=Cc2ccc(F)cc2)sc2n1C(c1cccc([N+](=O)[O-])c1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C27H18FN3O3S/c28-19-11-8-16(9-12-19)14-23-26(32)30-25(18-5-3-6-20(15-18)31(33)34)22-13-10-17-4-1-2-7-21(17)24(22)29-27(30)35-23/h1-9,11-12,14-15,25H,10,13H2 |
| InChIKey | PMUHOSSCZYJFDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|