C28H20BrN3O3S — CID 124631067
(11R,14E)-14-[(3-bromo-4-methylphenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124631067) has the molecular formula C28H20BrN3O3S and a molecular weight of 558.46 g/mol. Its IUPAC name is (11R,14E)-14-[(3-bromo-4-methylphenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[(3-bromo-4-methylphenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124631067 |
| Molecular Formula | C28H20BrN3O3S |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | (11R,14E)-14-[(3-bromo-4-methylphenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1ccc(/C=c2/sc3n(c2=O)[C@H](c2cccc([N+](=O)[O-])c2)C2=C(N=3)c3ccccc3CC2)cc1Br |
| InChI | InChI=1S/C28H20BrN3O3S/c1-16-9-10-17(13-23(16)29)14-24-27(33)31-26(19-6-4-7-20(15-19)32(34)35)22-12-11-18-5-2-3-8-21(18)25(22)30-28(31)36-24/h2-10,13-15,26H,11-12H2,1H3/b24-14+/t26-/m1/s1 |
| InChIKey | YYNLVZCYNOTWAS-JAYSWQADSA-N |
| XLogP | 5.30 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|