C29H21I2N3O4S — CID 124600198
(11S,14E)-14-[(4-ethoxy-3,5-diiodophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124600198) has the molecular formula C29H21I2N3O4S and a molecular weight of 761.38 g/mol. Its IUPAC name is (11S,14E)-14-[(4-ethoxy-3,5-diiodophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-[(4-ethoxy-3,5-diiodophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124600198 |
| Molecular Formula | C29H21I2N3O4S |
| Molecular Weight | 761.38 g/mol |
| Exact Mass | 760.93 |
| IUPAC Name | (11S,14E)-14-[(4-ethoxy-3,5-diiodophenyl)methylidene]-11-(3-nitrophenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCOc1c(I)cc(/C=c2/sc3n(c2=O)[C@@H](c2cccc([N+](=O)[O-])c2)C2=C(N=3)c3ccccc3CC2)cc1I |
| InChI | InChI=1S/C29H21I2N3O4S/c1-2-38-27-22(30)12-16(13-23(27)31)14-24-28(35)33-26(18-7-5-8-19(15-18)34(36)37)21-11-10-17-6-3-4-9-20(17)25(21)32-29(33)39-24/h3-9,12-15,26H,2,10-11H2,1H3/b24-14+/t26-/m0/s1 |
| InChIKey | MPSOESKMBRVRBE-KEQCBNTKSA-N |
| XLogP | 5.83 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|