C30H22IN3O6S — CID 124600136
[2-iodo-6-methoxy-4-[(E)-[(11R)-11-(3-nitrophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate (PubChem CID 124600136) has the molecular formula C30H22IN3O6S and a molecular weight of 679.49 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-[(E)-[(11R)-11-(3-nitrophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-iodo-6-methoxy-4-[(E)-[(11R)-11-(3-nitrophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 124600136 |
| Molecular Formula | C30H22IN3O6S |
| Molecular Weight | 679.49 g/mol |
| Exact Mass | 679.03 |
| IUPAC Name | [2-iodo-6-methoxy-4-[(E)-[(11R)-11-(3-nitrophenyl)-13-oxo-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-14-ylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=c2/sc3n(c2=O)[C@H](c2cccc([N+](=O)[O-])c2)C2=C(N=3)c3ccccc3CC2)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C30H22IN3O6S/c1-16(35)40-28-23(31)12-17(13-24(28)39-2)14-25-29(36)33-27(19-7-5-8-20(15-19)34(37)38)22-11-10-18-6-3-4-9-21(18)26(22)32-30(33)41-25/h3-9,12-15,27H,10-11H2,1-2H3/b25-14+/t27-/m1/s1 |
| InChIKey | CBDVFLFANQJCJB-LXYLXTGBSA-N |
| XLogP | 4.77 |
| TPSA | 113.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|